C16H14N3O4S- — CID 7150539
4-nitro-2-[(3S)-2-propanoyl-5-thiophen-2-yl-3,4-dihydropyrazol-3-yl]phenolate (PubChem CID 7150539) has the molecular formula C16H14N3O4S- and a molecular weight of 344.37 g/mol. Its IUPAC name is 4-nitro-2-[(3S)-2-propanoyl-5-thiophen-2-yl-3,4-dihydropyrazol-3-yl]phenolate.
| Compound Name | 4-nitro-2-[(3S)-2-propanoyl-5-thiophen-2-yl-3,4-dihydropyrazol-3-yl]phenolate |
|---|---|
| PubChem CID | 7150539 |
| Molecular Formula | C16H14N3O4S- |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-nitro-2-[(3S)-2-propanoyl-5-thiophen-2-yl-3,4-dihydropyrazol-3-yl]phenolate |
| SMILES | CCC(=O)N1N=C(c2cccs2)C[C@H]1c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C16H15N3O4S/c1-2-16(21)18-13(9-12(17-18)15-4-3-7-24-15)11-8-10(19(22)23)5-6-14(11)20/h3-8,13,20H,2,9H2,1H3/p-1/t13-/m0/s1 |
| InChIKey | WUJQCBQAKUHWKM-ZDUSSCGKSA-M |
| XLogP | 2.82 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|