C66H72O3 — CID 71506295
5,12,19-tris[2-(4-tert-butylphenyl)ethynyl]-6,13,20-tripropoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene (PubChem CID 71506295) has the molecular formula C66H72O3 and a molecular weight of 913.30 g/mol. Its IUPAC name is 5,12,19-tris[2-(4-tert-butylphenyl)ethynyl]-6,13,20-tripropoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene.
| Compound Name | 5,12,19-tris[2-(4-tert-butylphenyl)ethynyl]-6,13,20-tripropoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene |
|---|---|
| PubChem CID | 71506295 |
| Molecular Formula | C66H72O3 |
| Molecular Weight | 913.30 g/mol |
| Exact Mass | 912.55 |
| IUPAC Name | 5,12,19-tris[2-(4-tert-butylphenyl)ethynyl]-6,13,20-tripropoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene |
| SMILES | CCCOc1cc2c(cc1C#Cc1ccc(C(C)(C)C)cc1)Cc1cc(OCCC)c(C#Cc3ccc(C(C)(C)C)cc3)cc1Cc1cc(OCCC)c(C#Cc3ccc(C(C)(C)C)cc3)cc1C2 |
| InChI | InChI=1S/C66H72O3/c1-13-34-67-61-43-55-40-53-38-50(26-17-47-21-30-59(31-22-47)65(7,8)9)63(69-36-15-3)45-57(53)42-54-39-51(27-18-48-23-32-60(33-24-48)66(10,11)12)62(68-35-14-2)44-56(54)41-52(55)37-49(61)25-16-46-19-28-58(29-20-46)64(4,5)6/h19-24,28-33,37-39,43-45H,13-15,34-36,40-42H2,1-12H3 |
| InChIKey | XLCJILRHDHWYDS-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.30 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|