C26H30N2O3S — CID 71506796
1-cyclohexyl-N-[(5-nitrothiophen-2-yl)methyl]-N-[(3-phenylmethoxyphenyl)methyl]methanamine (PubChem CID 71506796) has the molecular formula C26H30N2O3S and a molecular weight of 450.60 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(5-nitrothiophen-2-yl)methyl]-N-[(3-phenylmethoxyphenyl)methyl]methanamine.
| Compound Name | 1-cyclohexyl-N-[(5-nitrothiophen-2-yl)methyl]-N-[(3-phenylmethoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 71506796 |
| Molecular Formula | C26H30N2O3S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 1-cyclohexyl-N-[(5-nitrothiophen-2-yl)methyl]-N-[(3-phenylmethoxyphenyl)methyl]methanamine |
| SMILES | O=[N+]([O-])c1ccc(CN(Cc2cccc(OCc3ccccc3)c2)CC2CCCCC2)s1 |
| InChI | InChI=1S/C26H30N2O3S/c29-28(30)26-15-14-25(32-26)19-27(17-21-8-3-1-4-9-21)18-23-12-7-13-24(16-23)31-20-22-10-5-2-6-11-22/h2,5-7,10-16,21H,1,3-4,8-9,17-20H2 |
| InChIKey | ULEZVQQODCQUGB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|