C16H28O3 — CID 71507137
(4R)-2,3-diethyl-4-hydroxy-4-[(1S)-1-hydroxyheptyl]cyclopent-2-en-1-one (PubChem CID 71507137) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (4R)-2,3-diethyl-4-hydroxy-4-[(1S)-1-hydroxyheptyl]cyclopent-2-en-1-one.
| Compound Name | (4R)-2,3-diethyl-4-hydroxy-4-[(1S)-1-hydroxyheptyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 71507137 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (4R)-2,3-diethyl-4-hydroxy-4-[(1S)-1-hydroxyheptyl]cyclopent-2-en-1-one |
| SMILES | CCCCCC[C@H](O)[C@@]1(O)CC(=O)C(CC)=C1CC |
| InChI | InChI=1S/C16H28O3/c1-4-7-8-9-10-15(18)16(19)11-14(17)12(5-2)13(16)6-3/h15,18-19H,4-11H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | OJHVPQVNKTZBQH-JKSUJKDBSA-N |
| XLogP | 3.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|