C15H15F2NO — CID 71507610
3,4-difluoro-N,N-dimethyl-5-phenylmethoxyaniline (PubChem CID 71507610) has the molecular formula C15H15F2NO and a molecular weight of 263.29 g/mol. Its IUPAC name is 3,4-difluoro-N,N-dimethyl-5-phenylmethoxyaniline.
| Compound Name | 3,4-difluoro-N,N-dimethyl-5-phenylmethoxyaniline |
|---|---|
| PubChem CID | 71507610 |
| Molecular Formula | C15H15F2NO |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3,4-difluoro-N,N-dimethyl-5-phenylmethoxyaniline |
| SMILES | CN(C)c1cc(F)c(F)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C15H15F2NO/c1-18(2)12-8-13(16)15(17)14(9-12)19-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3 |
| InChIKey | IMRSUHZWBAOGBL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |