C12H13F3N2S — CID 71508184
1-tert-butyl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazole (PubChem CID 71508184) has the molecular formula C12H13F3N2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-tert-butyl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-tert-butyl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 71508184 |
| Molecular Formula | C12H13F3N2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-tert-butyl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazole |
| SMILES | CC(C)(C)n1nc(C(F)(F)F)cc1-c1cccs1 |
| InChI | InChI=1S/C12H13F3N2S/c1-11(2,3)17-8(9-5-4-6-18-9)7-10(16-17)12(13,14)15/h4-7H,1-3H3 |
| InChIKey | LGRBUODIGJUAHZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |