C23H29FN2O4 — CID 71508741
1-(1,3-benzodioxol-5-ylmethyl)-4-[[4-[2-(2-fluoroethoxy)ethoxy]phenyl]methyl]piperazine (PubChem CID 71508741) has the molecular formula C23H29FN2O4 and a molecular weight of 416.49 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-[[4-[2-(2-fluoroethoxy)ethoxy]phenyl]methyl]piperazine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-[[4-[2-(2-fluoroethoxy)ethoxy]phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 71508741 |
| Molecular Formula | C23H29FN2O4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-[[4-[2-(2-fluoroethoxy)ethoxy]phenyl]methyl]piperazine |
| SMILES | FCCOCCOc1ccc(CN2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C23H29FN2O4/c24-7-12-27-13-14-28-21-4-1-19(2-5-21)16-25-8-10-26(11-9-25)17-20-3-6-22-23(15-20)30-18-29-22/h1-6,15H,7-14,16-18H2 |
| InChIKey | ZNQVUDLUHWGACJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|