C26H43FO2 — CID 71509667
(3S,10R,13R,17R)-3-(fluoromethyl)-17-(5-hydroxy-5-methylhexan-2-yl)-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 71509667) has the molecular formula C26H43FO2 and a molecular weight of 406.63 g/mol. Its IUPAC name is (3S,10R,13R,17R)-3-(fluoromethyl)-17-(5-hydroxy-5-methylhexan-2-yl)-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13R,17R)-3-(fluoromethyl)-17-(5-hydroxy-5-methylhexan-2-yl)-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 71509667 |
| Molecular Formula | C26H43FO2 |
| Molecular Weight | 406.63 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | (3S,10R,13R,17R)-3-(fluoromethyl)-17-(5-hydroxy-5-methylhexan-2-yl)-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(CCC(C)(C)O)[C@H]1CCC2C3CC=C4C[C@](O)(CF)CC[C@@H]4C3CC[C@@]21C |
| InChI | InChI=1S/C26H43FO2/c1-17(9-12-24(2,3)28)22-7-8-23-21-6-5-18-15-26(29,16-27)14-11-19(18)20(21)10-13-25(22,23)4/h5,17,19-23,28-29H,6-16H2,1-4H3/t17?,19-,20?,21?,22+,23?,25+,26-/m0/s1 |
| InChIKey | XFCVNHIZSSOCSM-LQYLYQTISA-N |
| XLogP | 6.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|