C27H41ClO2 — CID 78092011
3-(2-chloroethynyl)-17-(5-hydroxy-5-methylhexan-2-yl)-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 78092011) has the molecular formula C27H41ClO2 and a molecular weight of 433.08 g/mol. Its IUPAC name is 3-(2-chloroethynyl)-17-(5-hydroxy-5-methylhexan-2-yl)-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 3-(2-chloroethynyl)-17-(5-hydroxy-5-methylhexan-2-yl)-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 78092011 |
| Molecular Formula | C27H41ClO2 |
| Molecular Weight | 433.08 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 3-(2-chloroethynyl)-17-(5-hydroxy-5-methylhexan-2-yl)-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(CCC(C)(C)O)C1CCC2C3CC=C4CC(O)(C#CCl)CCC4C3CCC12C |
| InChI | InChI=1S/C27H41ClO2/c1-18(9-12-25(2,3)29)23-7-8-24-22-6-5-19-17-27(30,15-16-28)14-11-20(19)21(22)10-13-26(23,24)4/h5,18,20-24,29-30H,6-14,17H2,1-4H3 |
| InChIKey | ALHWYSTYILUPEI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.08 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|