C30H20N2O2 — CID 71514633
4-methyl-7-nitro-1-phenylspiro[cyclopenta[b]indole-3,9'-fluorene] (PubChem CID 71514633) has the molecular formula C30H20N2O2 and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-methyl-7-nitro-1-phenylspiro[cyclopenta[b]indole-3,9'-fluorene].
| Compound Name | 4-methyl-7-nitro-1-phenylspiro[cyclopenta[b]indole-3,9'-fluorene] |
|---|---|
| PubChem CID | 71514633 |
| Molecular Formula | C30H20N2O2 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 4-methyl-7-nitro-1-phenylspiro[cyclopenta[b]indole-3,9'-fluorene] |
| SMILES | Cn1c2c(c3cc([N+](=O)[O-])ccc31)C(c1ccccc1)=CC21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H20N2O2/c1-31-27-16-15-20(32(33)34)17-23(27)28-24(19-9-3-2-4-10-19)18-30(29(28)31)25-13-7-5-11-21(25)22-12-6-8-14-26(22)30/h2-18H,1H3 |
| InChIKey | WANYRWPEMWTDPL-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|