C27H24N2O4 — CID 166447255
(5R)-5-(2-hydroxy-2-methylpropyl)-5-methyl-10-nitro-12-phenylindolo[2,1-a]isoquinolin-6-one (PubChem CID 166447255) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is (5R)-5-(2-hydroxy-2-methylpropyl)-5-methyl-10-nitro-12-phenylindolo[2,1-a]isoquinolin-6-one.
| Compound Name | (5R)-5-(2-hydroxy-2-methylpropyl)-5-methyl-10-nitro-12-phenylindolo[2,1-a]isoquinolin-6-one |
|---|---|
| PubChem CID | 166447255 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (5R)-5-(2-hydroxy-2-methylpropyl)-5-methyl-10-nitro-12-phenylindolo[2,1-a]isoquinolin-6-one |
| SMILES | CC(C)(O)C[C@@]1(C)C(=O)n2c(c(-c3ccccc3)c3cc([N+](=O)[O-])ccc32)-c2ccccc21 |
| InChI | InChI=1S/C27H24N2O4/c1-26(2,31)16-27(3)21-12-8-7-11-19(21)24-23(17-9-5-4-6-10-17)20-15-18(29(32)33)13-14-22(20)28(24)25(27)30/h4-15,31H,16H2,1-3H3/t27-/m1/s1 |
| InChIKey | DBZOTMJVPPGGRK-HHHXNRCGSA-N |
| XLogP | 5.96 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|