C25H18N2OSe — CID 172557894
(5-methyl-6-oxo-12-phenylindolo[2,1-a]isoquinolin-5-yl)methyl selenocyanate (PubChem CID 172557894) has the molecular formula C25H18N2OSe and a molecular weight of 441.39 g/mol. Its IUPAC name is (5-methyl-6-oxo-12-phenylindolo[2,1-a]isoquinolin-5-yl)methyl selenocyanate.
| Compound Name | (5-methyl-6-oxo-12-phenylindolo[2,1-a]isoquinolin-5-yl)methyl selenocyanate |
|---|---|
| PubChem CID | 172557894 |
| Molecular Formula | C25H18N2OSe |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | (5-methyl-6-oxo-12-phenylindolo[2,1-a]isoquinolin-5-yl)methyl selenocyanate |
| SMILES | CC1(C[Se]C#N)C(=O)n2c(c(-c3ccccc3)c3ccccc32)-c2ccccc21 |
| InChI | InChI=1S/C25H18N2OSe/c1-25(15-29-16-26)20-13-7-5-11-18(20)23-22(17-9-3-2-4-10-17)19-12-6-8-14-21(19)27(23)24(25)28/h2-14H,15H2,1H3 |
| InChIKey | WWUZGCPPMUVVAJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|