C19H14N2OSe — CID 172557886
(5-methyl-6-oxoindolo[2,1-a]isoquinolin-5-yl)methyl selenocyanate (PubChem CID 172557886) has the molecular formula C19H14N2OSe and a molecular weight of 365.29 g/mol. Its IUPAC name is (5-methyl-6-oxoindolo[2,1-a]isoquinolin-5-yl)methyl selenocyanate.
| Compound Name | (5-methyl-6-oxoindolo[2,1-a]isoquinolin-5-yl)methyl selenocyanate |
|---|---|
| PubChem CID | 172557886 |
| Molecular Formula | C19H14N2OSe |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (5-methyl-6-oxoindolo[2,1-a]isoquinolin-5-yl)methyl selenocyanate |
| SMILES | CC1(C[Se]C#N)C(=O)n2c(cc3ccccc32)-c2ccccc21 |
| InChI | InChI=1S/C19H14N2OSe/c1-19(11-23-12-20)15-8-4-3-7-14(15)17-10-13-6-2-5-9-16(13)21(17)18(19)22/h2-10H,11H2,1H3 |
| InChIKey | DAYQWYYCSDZWOD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|