C23H28N2OSi — CID 156788914
5-[[tert-butyl(dimethyl)silyl]methyl]-5-methylbenzimidazolo[2,1-a]isoquinolin-6-one (PubChem CID 156788914) has the molecular formula C23H28N2OSi and a molecular weight of 376.58 g/mol. Its IUPAC name is 5-[[tert-butyl(dimethyl)silyl]methyl]-5-methylbenzimidazolo[2,1-a]isoquinolin-6-one.
| Compound Name | 5-[[tert-butyl(dimethyl)silyl]methyl]-5-methylbenzimidazolo[2,1-a]isoquinolin-6-one |
|---|---|
| PubChem CID | 156788914 |
| Molecular Formula | C23H28N2OSi |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 5-[[tert-butyl(dimethyl)silyl]methyl]-5-methylbenzimidazolo[2,1-a]isoquinolin-6-one |
| SMILES | CC1(C[Si](C)(C)C(C)(C)C)C(=O)n2c(nc3ccccc32)-c2ccccc21 |
| InChI | InChI=1S/C23H28N2OSi/c1-22(2,3)27(5,6)15-23(4)17-12-8-7-11-16(17)20-24-18-13-9-10-14-19(18)25(20)21(23)26/h7-14H,15H2,1-6H3 |
| InChIKey | AOGVNTAYABNVOI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|