C23H26F2N2OSi — CID 156788928
9,10-difluoro-5-methyl-5-(triethylsilylmethyl)benzimidazolo[2,1-a]isoquinolin-6-one (PubChem CID 156788928) has the molecular formula C23H26F2N2OSi and a molecular weight of 412.56 g/mol. Its IUPAC name is 9,10-difluoro-5-methyl-5-(triethylsilylmethyl)benzimidazolo[2,1-a]isoquinolin-6-one.
| Compound Name | 9,10-difluoro-5-methyl-5-(triethylsilylmethyl)benzimidazolo[2,1-a]isoquinolin-6-one |
|---|---|
| PubChem CID | 156788928 |
| Molecular Formula | C23H26F2N2OSi |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 9,10-difluoro-5-methyl-5-(triethylsilylmethyl)benzimidazolo[2,1-a]isoquinolin-6-one |
| SMILES | CC[Si](CC)(CC)CC1(C)C(=O)n2c(nc3cc(F)c(F)cc32)-c2ccccc21 |
| InChI | InChI=1S/C23H26F2N2OSi/c1-5-29(6-2,7-3)14-23(4)16-11-9-8-10-15(16)21-26-19-12-17(24)18(25)13-20(19)27(21)22(23)28/h8-13H,5-7,14H2,1-4H3 |
| InChIKey | YBASMMULVJRAIM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|