C18H13N3OS — CID 164675633
[(5R)-5-methyl-6-oxobenzimidazolo[2,1-a]isoquinolin-5-yl]methyl thiocyanate (PubChem CID 164675633) has the molecular formula C18H13N3OS and a molecular weight of 319.39 g/mol. Its IUPAC name is [(5R)-5-methyl-6-oxobenzimidazolo[2,1-a]isoquinolin-5-yl]methyl thiocyanate.
| Compound Name | [(5R)-5-methyl-6-oxobenzimidazolo[2,1-a]isoquinolin-5-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 164675633 |
| Molecular Formula | C18H13N3OS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | [(5R)-5-methyl-6-oxobenzimidazolo[2,1-a]isoquinolin-5-yl]methyl thiocyanate |
| SMILES | C[C@]1(CSC#N)C(=O)n2c(nc3ccccc32)-c2ccccc21 |
| InChI | InChI=1S/C18H13N3OS/c1-18(10-23-11-19)13-7-3-2-6-12(13)16-20-14-8-4-5-9-15(14)21(16)17(18)22/h2-9H,10H2,1H3/t18-/m1/s1 |
| InChIKey | XXGYUWDHOLBRTP-GOSISDBHSA-N |
| XLogP | 3.83 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|