C25H24N2OSi — CID 156788934
5-[[dimethyl(phenyl)silyl]methyl]-5-methylbenzimidazolo[2,1-a]isoquinolin-6-one (PubChem CID 156788934) has the molecular formula C25H24N2OSi and a molecular weight of 396.57 g/mol. Its IUPAC name is 5-[[dimethyl(phenyl)silyl]methyl]-5-methylbenzimidazolo[2,1-a]isoquinolin-6-one.
| Compound Name | 5-[[dimethyl(phenyl)silyl]methyl]-5-methylbenzimidazolo[2,1-a]isoquinolin-6-one |
|---|---|
| PubChem CID | 156788934 |
| Molecular Formula | C25H24N2OSi |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 5-[[dimethyl(phenyl)silyl]methyl]-5-methylbenzimidazolo[2,1-a]isoquinolin-6-one |
| SMILES | CC1(C[Si](C)(C)c2ccccc2)C(=O)n2c(nc3ccccc32)-c2ccccc21 |
| InChI | InChI=1S/C25H24N2OSi/c1-25(17-29(2,3)18-11-5-4-6-12-18)20-14-8-7-13-19(20)23-26-21-15-9-10-16-22(21)27(23)24(25)28/h4-16H,17H2,1-3H3 |
| InChIKey | WVHHYTJNCJQTJF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|