C31H52N4O3 — CID 71514870
(4S)-4-[(2S)-2-hydroxyheptyl]-5-methyl-1-[4-[(4S)-5-methyl-2-oxo-4-phenyl-1,5-diazocan-1-yl]butyl]-1,5-diazocan-2-one (PubChem CID 71514870) has the molecular formula C31H52N4O3 and a molecular weight of 528.78 g/mol. Its IUPAC name is (4S)-4-[(2S)-2-hydroxyheptyl]-5-methyl-1-[4-[(4S)-5-methyl-2-oxo-4-phenyl-1,5-diazocan-1-yl]butyl]-1,5-diazocan-2-one.
| Compound Name | (4S)-4-[(2S)-2-hydroxyheptyl]-5-methyl-1-[4-[(4S)-5-methyl-2-oxo-4-phenyl-1,5-diazocan-1-yl]butyl]-1,5-diazocan-2-one |
|---|---|
| PubChem CID | 71514870 |
| Molecular Formula | C31H52N4O3 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | (4S)-4-[(2S)-2-hydroxyheptyl]-5-methyl-1-[4-[(4S)-5-methyl-2-oxo-4-phenyl-1,5-diazocan-1-yl]butyl]-1,5-diazocan-2-one |
| SMILES | CCCCC[C@H](O)C[C@H]1CC(=O)N(CCCCN2CCCN(C)[C@H](c3ccccc3)CC2=O)CCCN1C |
| InChI | InChI=1S/C31H52N4O3/c1-4-5-7-16-28(36)23-27-24-30(37)34(21-12-17-32(27)2)19-10-11-20-35-22-13-18-33(3)29(25-31(35)38)26-14-8-6-9-15-26/h6,8-9,14-15,27-29,36H,4-5,7,10-13,16-25H2,1-3H3/t27-,28-,29-/m0/s1 |
| InChIKey | YOIQTGQBNQQIQU-AWCRTANDSA-N |
| XLogP | 4.32 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|