C30H42N4O2 — CID 177447150
(4R)-5-methyl-1-[4-[(4R)-5-methyl-2-oxo-4-phenyl-1,5-diazocan-1-yl]butyl]-4-phenyl-1,5-diazocan-2-one (PubChem CID 177447150) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is (4R)-5-methyl-1-[4-[(4R)-5-methyl-2-oxo-4-phenyl-1,5-diazocan-1-yl]butyl]-4-phenyl-1,5-diazocan-2-one.
| Compound Name | (4R)-5-methyl-1-[4-[(4R)-5-methyl-2-oxo-4-phenyl-1,5-diazocan-1-yl]butyl]-4-phenyl-1,5-diazocan-2-one |
|---|---|
| PubChem CID | 177447150 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | (4R)-5-methyl-1-[4-[(4R)-5-methyl-2-oxo-4-phenyl-1,5-diazocan-1-yl]butyl]-4-phenyl-1,5-diazocan-2-one |
| SMILES | CN1CCCN(CCCCN2CCCN(C)[C@@H](c3ccccc3)CC2=O)C(=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H42N4O2/c1-31-17-11-21-33(29(35)23-27(31)25-13-5-3-6-14-25)19-9-10-20-34-22-12-18-32(2)28(24-30(34)36)26-15-7-4-8-16-26/h3-8,13-16,27-28H,9-12,17-24H2,1-2H3/t27-,28-/m1/s1 |
| InChIKey | LNCIXDIFZNXBDP-VSGBNLITSA-N |
| XLogP | 4.36 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|