C27H31BrFN5O3 — CID 71514899
tert-butyl N-[4-[[5-bromo-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]amino]cyclohexyl]carbamate (PubChem CID 71514899) has the molecular formula C27H31BrFN5O3 and a molecular weight of 572.48 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-bromo-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-bromo-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 71514899 |
| Molecular Formula | C27H31BrFN5O3 |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | tert-butyl N-[4-[[5-bromo-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Nc2c(C(=O)NCc3ccc(F)cc3)nc(Br)c3cccnc23)CC1 |
| InChI | InChI=1S/C27H31BrFN5O3/c1-27(2,3)37-26(36)33-19-12-10-18(11-13-19)32-22-21-20(5-4-14-30-21)24(28)34-23(22)25(35)31-15-16-6-8-17(29)9-7-16/h4-9,14,18-19,32H,10-13,15H2,1-3H3,(H,31,35)(H,33,36) |
| InChIKey | LRQYRJXHFSLZLY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|