C34H52N2OSn — CID 71515315
tributyl-[6-[(1-propylpiperidin-4-yl)methoxy]phenanthridin-4-yl]stannane (PubChem CID 71515315) has the molecular formula C34H52N2OSn and a molecular weight of 623.51 g/mol. Its IUPAC name is tributyl-[6-[(1-propylpiperidin-4-yl)methoxy]phenanthridin-4-yl]stannane.
| Compound Name | tributyl-[6-[(1-propylpiperidin-4-yl)methoxy]phenanthridin-4-yl]stannane |
|---|---|
| PubChem CID | 71515315 |
| Molecular Formula | C34H52N2OSn |
| Molecular Weight | 623.51 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | tributyl-[6-[(1-propylpiperidin-4-yl)methoxy]phenanthridin-4-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc2c1nc(OCC1CCN(CCC)CC1)c1ccccc12 |
| InChI | InChI=1S/C22H25N2O.3C4H9.Sn/c1-2-13-24-14-11-17(12-15-24)16-25-22-20-9-4-3-7-18(20)19-8-5-6-10-21(19)23-22;3*1-3-4-2;/h3-9,17H,2,11-16H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | SQOSHLJUWNQMQY-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.51 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|