C15H10BrF3N4O — CID 71515696
2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine (PubChem CID 71515696) has the molecular formula C15H10BrF3N4O and a molecular weight of 399.17 g/mol. Its IUPAC name is 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine.
| Compound Name | 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 71515696 |
| Molecular Formula | C15H10BrF3N4O |
| Molecular Weight | 399.17 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine |
| SMILES | Nc1cc(C(F)(F)F)c(Br)nc1-c1nnc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C15H10BrF3N4O/c16-13-9(15(17,18)19)7-10(20)12(21-13)14-23-22-11(24-14)6-8-4-2-1-3-5-8/h1-5,7H,6,20H2 |
| InChIKey | ZCPYJTVACTXCQN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.17 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|