About 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine
2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine (PubChem CID 71515696) has the molecular formula C15H10BrF3N4O
and a molecular weight of 399.17 g/mol. Its IUPAC name is 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine |
| PubChem CID | 71515696 |
| Molecular Formula | C15H10BrF3N4O |
| Molecular Weight | 399.17 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine |
| SMILES | Nc1cc(C(F)(F)F)c(Br)nc1-c1nnc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C15H10BrF3N4O/c16-13-9(15(17,18)19)7-10(20)12(21-13)14-23-22-11(24-14)6-8-4-2-1-3-5-8/h1-5,7H,6,20H2 |
| InChIKey | ZCPYJTVACTXCQN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.17 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine?
The IUPAC name of 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine (CID 71515696) is 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine.
What is the SMILES notation for 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine?
The canonical SMILES for 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine is Nc1cc(C(F)(F)F)c(Br)nc1-c1nnc(Cc2ccccc2)o1.
What is the InChIKey of 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine?
The InChIKey is ZCPYJTVACTXCQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrF3N4O/c16-13-9(15(17,18)19)7-10(20)12(21-13)14-23-22-11(24-14)6-8-4-2-1-3-5-8/h1-5,7H,6,20H2.
What are the key properties of 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine?
2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine has a molecular weight of 399.17 g/mol, XLogP of 4.09, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-benzyl-1,3,4-oxadiazol-2-yl)-6-bromo-5-(trifluoromethyl)pyridin-3-amine is sourced from PubChem (CID 71515696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).