C15H9BrF4N4O — CID 71515699
6-bromo-2-[5-[(4-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)pyridin-3-amine (PubChem CID 71515699) has the molecular formula C15H9BrF4N4O and a molecular weight of 417.16 g/mol. Its IUPAC name is 6-bromo-2-[5-[(4-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)pyridin-3-amine.
| Compound Name | 6-bromo-2-[5-[(4-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 71515699 |
| Molecular Formula | C15H9BrF4N4O |
| Molecular Weight | 417.16 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | 6-bromo-2-[5-[(4-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)pyridin-3-amine |
| SMILES | Nc1cc(C(F)(F)F)c(Br)nc1-c1nnc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C15H9BrF4N4O/c16-13-9(15(18,19)20)6-10(21)12(22-13)14-24-23-11(25-14)5-7-1-3-8(17)4-2-7/h1-4,6H,5,21H2 |
| InChIKey | IHIINHACUFECAC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.16 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|