C10H5BrF6N4O — CID 71515700
6-bromo-2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)pyridin-3-amine (PubChem CID 71515700) has the molecular formula C10H5BrF6N4O and a molecular weight of 391.07 g/mol. Its IUPAC name is 6-bromo-2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)pyridin-3-amine.
| Compound Name | 6-bromo-2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 71515700 |
| Molecular Formula | C10H5BrF6N4O |
| Molecular Weight | 391.07 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 6-bromo-2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]-5-(trifluoromethyl)pyridin-3-amine |
| SMILES | Nc1cc(C(F)(F)F)c(Br)nc1-c1nnc(CC(F)(F)F)o1 |
| InChI | InChI=1S/C10H5BrF6N4O/c11-7-3(10(15,16)17)1-4(18)6(19-7)8-21-20-5(22-8)2-9(12,13)14/h1H,2,18H2 |
| InChIKey | IZHFOJCLLGHOHL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.07 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|