C25H29NO10S2 — CID 71518455
triethyl (3R,4R,5S)-3,4-bis(benzenesulfonyl)pyrrolidine-2,2,5-tricarboxylate (PubChem CID 71518455) has the molecular formula C25H29NO10S2 and a molecular weight of 567.64 g/mol. Its IUPAC name is triethyl (3R,4R,5S)-3,4-bis(benzenesulfonyl)pyrrolidine-2,2,5-tricarboxylate.
| Compound Name | triethyl (3R,4R,5S)-3,4-bis(benzenesulfonyl)pyrrolidine-2,2,5-tricarboxylate |
|---|---|
| PubChem CID | 71518455 |
| Molecular Formula | C25H29NO10S2 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | triethyl (3R,4R,5S)-3,4-bis(benzenesulfonyl)pyrrolidine-2,2,5-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1NC(C(=O)OCC)(C(=O)OCC)[C@@H](S(=O)(=O)c2ccccc2)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H29NO10S2/c1-4-34-22(27)19-20(37(30,31)17-13-9-7-10-14-17)21(38(32,33)18-15-11-8-12-16-18)25(26-19,23(28)35-5-2)24(29)36-6-3/h7-16,19-21,26H,4-6H2,1-3H3/t19-,20-,21+/m1/s1 |
| InChIKey | YSRHVBLGCYNZBG-NJYVYQBISA-N |
| XLogP | 1.07 |
| TPSA | 159.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|