C15H22N2O4 — CID 71520717
N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethylbenzamide (PubChem CID 71520717) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethylbenzamide.
| Compound Name | N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 71520717 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NOCCCCCC(=O)NO)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-11-8-12(2)10-13(9-11)15(19)17-21-7-5-3-4-6-14(18)16-20/h8-10,20H,3-7H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | VRYZCEONIWEUAV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|