C28H45NOSSn — CID 71521438
[2-[2-[(dimethylamino)methyl]-4-tributylstannylphenyl]sulfanylphenyl]methanol (PubChem CID 71521438) has the molecular formula C28H45NOSSn and a molecular weight of 562.45 g/mol. Its IUPAC name is [2-[2-[(dimethylamino)methyl]-4-tributylstannylphenyl]sulfanylphenyl]methanol.
| Compound Name | [2-[2-[(dimethylamino)methyl]-4-tributylstannylphenyl]sulfanylphenyl]methanol |
|---|---|
| PubChem CID | 71521438 |
| Molecular Formula | C28H45NOSSn |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | [2-[2-[(dimethylamino)methyl]-4-tributylstannylphenyl]sulfanylphenyl]methanol |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(Sc2ccccc2CO)c(CN(C)C)c1 |
| InChI | InChI=1S/C16H18NOS.3C4H9.Sn/c1-17(2)11-13-7-3-5-9-15(13)19-16-10-6-4-8-14(16)12-18;3*1-3-4-2;/h4-10,18H,11-12H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | OOMFEBSDHCXFMD-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |