C20H21N3O5 — CID 71523510
(E)-N-[4-[[benzoyl(2-hydroxyethyl)amino]methyl]phenyl]-N'-hydroxybut-2-enediamide (PubChem CID 71523510) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is (E)-N-[4-[[benzoyl(2-hydroxyethyl)amino]methyl]phenyl]-N'-hydroxybut-2-enediamide.
| Compound Name | (E)-N-[4-[[benzoyl(2-hydroxyethyl)amino]methyl]phenyl]-N'-hydroxybut-2-enediamide |
|---|---|
| PubChem CID | 71523510 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (E)-N-[4-[[benzoyl(2-hydroxyethyl)amino]methyl]phenyl]-N'-hydroxybut-2-enediamide |
| SMILES | O=C(/C=C/C(=O)Nc1ccc(CN(CCO)C(=O)c2ccccc2)cc1)NO |
| InChI | InChI=1S/C20H21N3O5/c24-13-12-23(20(27)16-4-2-1-3-5-16)14-15-6-8-17(9-7-15)21-18(25)10-11-19(26)22-28/h1-11,24,28H,12-14H2,(H,21,25)(H,22,26)/b11-10+ |
| InChIKey | PNNNWWJYYBAKAQ-ZHACJKMWSA-N |
| XLogP | 1.32 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|