C28H17F9N2O2 — CID 71525463
3-[2-[(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 71525463) has the molecular formula C28H17F9N2O2 and a molecular weight of 584.44 g/mol. Its IUPAC name is 3-[2-[(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[2-[(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 71525463 |
| Molecular Formula | C28H17F9N2O2 |
| Molecular Weight | 584.44 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 3-[2-[(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(C(F)(F)F)cc2[C@@H]2CC[C@H]3[C@@H](c4cc(C(F)(F)F)cc(C(F)(F)F)c4)OC(=O)N23)c1 |
| InChI | InChI=1S/C28H17F9N2O2/c29-26(30,31)17-4-5-20(15-3-1-2-14(8-15)13-38)21(12-17)22-6-7-23-24(41-25(40)39(22)23)16-9-18(27(32,33)34)11-19(10-16)28(35,36)37/h1-5,8-12,22-24H,6-7H2/t22-,23-,24+/m0/s1 |
| InChIKey | KEDSCISGJUZOKI-KMDXXIMOSA-N |
| XLogP | 8.68 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.44 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |