C30H56N2O6 — CID 71526155
3-[3-methyl-2-(octanoylamino)butanoyl]oxybutyl 3-methyl-2-(octanoylamino)butanoate (PubChem CID 71526155) has the molecular formula C30H56N2O6 and a molecular weight of 540.79 g/mol. Its IUPAC name is 3-[3-methyl-2-(octanoylamino)butanoyl]oxybutyl 3-methyl-2-(octanoylamino)butanoate.
| Compound Name | 3-[3-methyl-2-(octanoylamino)butanoyl]oxybutyl 3-methyl-2-(octanoylamino)butanoate |
|---|---|
| PubChem CID | 71526155 |
| Molecular Formula | C30H56N2O6 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.41 |
| IUPAC Name | 3-[3-methyl-2-(octanoylamino)butanoyl]oxybutyl 3-methyl-2-(octanoylamino)butanoate |
| SMILES | CCCCCCCC(=O)NC(C(=O)OCCC(C)OC(=O)C(NC(=O)CCCCCCC)C(C)C)C(C)C |
| InChI | InChI=1S/C30H56N2O6/c1-8-10-12-14-16-18-25(33)31-27(22(3)4)29(35)37-21-20-24(7)38-30(36)28(23(5)6)32-26(34)19-17-15-13-11-9-2/h22-24,27-28H,8-21H2,1-7H3,(H,31,33)(H,32,34) |
| InChIKey | PJZYCALRCIHWRN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|