C13H14FNO2 — CID 71527214
ethyl 5-fluoro-6-methyl-1,2-dihydroquinoline-3-carboxylate (PubChem CID 71527214) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is ethyl 5-fluoro-6-methyl-1,2-dihydroquinoline-3-carboxylate.
| Compound Name | ethyl 5-fluoro-6-methyl-1,2-dihydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 71527214 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | ethyl 5-fluoro-6-methyl-1,2-dihydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2c(ccc(C)c2F)NC1 |
| InChI | InChI=1S/C13H14FNO2/c1-3-17-13(16)9-6-10-11(15-7-9)5-4-8(2)12(10)14/h4-6,15H,3,7H2,1-2H3 |
| InChIKey | LKYPQWLQKCHMCV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |