C14H10FN3O — CID 71527254
N-(4-fluorophenyl)-5-phenyl-1,3,4-oxadiazol-2-amine (PubChem CID 71527254) has the molecular formula C14H10FN3O and a molecular weight of 255.25 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-phenyl-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(4-fluorophenyl)-5-phenyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 71527254 |
| Molecular Formula | C14H10FN3O |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(4-fluorophenyl)-5-phenyl-1,3,4-oxadiazol-2-amine |
| SMILES | Fc1ccc(Nc2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C14H10FN3O/c15-11-6-8-12(9-7-11)16-14-18-17-13(19-14)10-4-2-1-3-5-10/h1-9H,(H,16,18) |
| InChIKey | ABBNYVKWUSKFEI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |