C15H12FN3O2 — CID 155807608
5-(4-fluorophenyl)-N-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 155807608) has the molecular formula C15H12FN3O2 and a molecular weight of 285.28 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 155807608 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | COc1ccc(Nc2nnc(-c3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C15H12FN3O2/c1-20-13-8-6-12(7-9-13)17-15-19-18-14(21-15)10-2-4-11(16)5-3-10/h2-9H,1H3,(H,17,19) |
| InChIKey | BMAJWALEKVEPRR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |