C21H16F2N6O2S — CID 71528324
8-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[1,3]thiazolo[5,4-f]quinazolin-9-one (PubChem CID 71528324) has the molecular formula C21H16F2N6O2S and a molecular weight of 454.46 g/mol. Its IUPAC name is 8-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[1,3]thiazolo[5,4-f]quinazolin-9-one.
| Compound Name | 8-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[1,3]thiazolo[5,4-f]quinazolin-9-one |
|---|---|
| PubChem CID | 71528324 |
| Molecular Formula | C21H16F2N6O2S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 8-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[1,3]thiazolo[5,4-f]quinazolin-9-one |
| SMILES | C[C@@H](n1cnc2ccc3ncsc3c2c1=O)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H16F2N6O2S/c1-12(29-10-25-16-4-5-17-19(32-11-26-17)18(16)20(29)30)21(31,7-28-9-24-8-27-28)14-3-2-13(22)6-15(14)23/h2-6,8-12,31H,7H2,1H3/t12-,21-/m1/s1 |
| InChIKey | GKGVZUKJGPCCGC-XUSGNXJCSA-N |
| XLogP | 3.02 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |