C27H23F2N7O4S — CID 78190529
[[amino-[4-[3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-oxothieno[3,2-d]pyrimidin-6-yl]phenyl]methylidene]amino] acetate (PubChem CID 78190529) has the molecular formula C27H23F2N7O4S and a molecular weight of 579.59 g/mol. Its IUPAC name is [[amino-[4-[3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-oxothieno[3,2-d]pyrimidin-6-yl]phenyl]methylidene]amino] acetate.
| Compound Name | [[amino-[4-[3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-oxothieno[3,2-d]pyrimidin-6-yl]phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 78190529 |
| Molecular Formula | C27H23F2N7O4S |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | [[amino-[4-[3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-oxothieno[3,2-d]pyrimidin-6-yl]phenyl]methylidene]amino] acetate |
| SMILES | CC(=O)ON=C(N)c1ccc(-c2cc3ncn(C(C)C(O)(Cn4cncn4)c4ccc(F)cc4F)c(=O)c3s2)cc1 |
| InChI | InChI=1S/C27H23F2N7O4S/c1-15(27(39,11-35-13-31-12-33-35)20-8-7-19(28)9-21(20)29)36-14-32-22-10-23(41-24(22)26(36)38)17-3-5-18(6-4-17)25(30)34-40-16(2)37/h3-10,12-15,39H,11H2,1-2H3,(H2,30,34) |
| InChIKey | DAMXFQWWKQQSQO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 150.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|