C28H24O4 — CID 71529894
(1S,10bS)-1-(2-methylpropyl)-1,4-diphenyl-10bH-pyrano[3,4-c]chromene-2,5-dione (PubChem CID 71529894) has the molecular formula C28H24O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is (1S,10bS)-1-(2-methylpropyl)-1,4-diphenyl-10bH-pyrano[3,4-c]chromene-2,5-dione.
| Compound Name | (1S,10bS)-1-(2-methylpropyl)-1,4-diphenyl-10bH-pyrano[3,4-c]chromene-2,5-dione |
|---|---|
| PubChem CID | 71529894 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (1S,10bS)-1-(2-methylpropyl)-1,4-diphenyl-10bH-pyrano[3,4-c]chromene-2,5-dione |
| SMILES | CC(C)C[C@]1(c2ccccc2)C(=O)OC(c2ccccc2)=C2C(=O)Oc3ccccc3[C@H]21 |
| InChI | InChI=1S/C28H24O4/c1-18(2)17-28(20-13-7-4-8-14-20)24-21-15-9-10-16-22(21)31-26(29)23(24)25(32-27(28)30)19-11-5-3-6-12-19/h3-16,18,24H,17H2,1-2H3/t24-,28-/m1/s1 |
| InChIKey | OISVDCOVMGWSHF-UFHPHHKVSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|