C23H31NO3 — CID 71530142
(1R,9R,10S)-11-(cyclopropylmethyl)-10-(2-hydroxyethyl)-4-methoxy-11-azatetracyclo[7.4.4.01,9.02,7]heptadeca-2(7),3,5-trien-15-one (PubChem CID 71530142) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (1R,9R,10S)-11-(cyclopropylmethyl)-10-(2-hydroxyethyl)-4-methoxy-11-azatetracyclo[7.4.4.01,9.02,7]heptadeca-2(7),3,5-trien-15-one.
| Compound Name | (1R,9R,10S)-11-(cyclopropylmethyl)-10-(2-hydroxyethyl)-4-methoxy-11-azatetracyclo[7.4.4.01,9.02,7]heptadeca-2(7),3,5-trien-15-one |
|---|---|
| PubChem CID | 71530142 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (1R,9R,10S)-11-(cyclopropylmethyl)-10-(2-hydroxyethyl)-4-methoxy-11-azatetracyclo[7.4.4.01,9.02,7]heptadeca-2(7),3,5-trien-15-one |
| SMILES | COc1ccc2c(c1)[C@]13CCN(CC4CC4)[C@@H](CCO)[C@]1(CCC(=O)C3)C2 |
| InChI | InChI=1S/C23H31NO3/c1-27-19-5-4-17-13-23-8-6-18(26)14-22(23,20(17)12-19)9-10-24(15-16-2-3-16)21(23)7-11-25/h4-5,12,16,21,25H,2-3,6-11,13-15H2,1H3/t21-,22+,23-/m0/s1 |
| InChIKey | NCHZGJYPEVWIMJ-ZRBLBEILSA-N |
| XLogP | 3.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |