C16H27NO4Si — CID 71530207
1-O-tert-butyl 2-O-methyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 71530207) has the molecular formula C16H27NO4Si and a molecular weight of 325.48 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71530207 |
| Molecular Formula | C16H27NO4Si |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C#C[Si](C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO4Si/c1-16(2,3)21-15(19)17-12(10-11-22(5,6)7)8-9-13(17)14(18)20-4/h12-13H,8-9H2,1-7H3/t12-,13-/m0/s1 |
| InChIKey | VLCFBJOEVOBIES-STQMWFEESA-N |
| XLogP | 2.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|