C27H35NO4S2 — CID 71530293
O-[(1'R,9'R,11'R,12'S,14'R)-15'-(cyclopropylmethyl)-4'-methoxyspiro[1,3-dioxolane-2,19'-15-azapentacyclo[9.6.2.01,9.02,7.09,14]nonadeca-2(7),3,5-triene]-12'-yl] methylsulfanylmethanethioate (PubChem CID 71530293) has the molecular formula C27H35NO4S2 and a molecular weight of 501.71 g/mol. Its IUPAC name is O-[(1'R,9'R,11'R,12'S,14'R)-15'-(cyclopropylmethyl)-4'-methoxyspiro[1,3-dioxolane-2,19'-15-azapentacyclo[9.6.2.01,9.02,7.09,14]nonadeca-2(7),3,5-triene]-12'-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(1'R,9'R,11'R,12'S,14'R)-15'-(cyclopropylmethyl)-4'-methoxyspiro[1,3-dioxolane-2,19'-15-azapentacyclo[9.6.2.01,9.02,7.09,14]nonadeca-2(7),3,5-triene]-12'-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 71530293 |
| Molecular Formula | C27H35NO4S2 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | O-[(1'R,9'R,11'R,12'S,14'R)-15'-(cyclopropylmethyl)-4'-methoxyspiro[1,3-dioxolane-2,19'-15-azapentacyclo[9.6.2.01,9.02,7.09,14]nonadeca-2(7),3,5-triene]-12'-yl] methylsulfanylmethanethioate |
| SMILES | COc1ccc2c(c1)[C@]13CCN(CC4CC4)[C@@H]4C[C@H](OC(=S)SC)[C@@H](C[C@]41C2)C1(C3)OCCO1 |
| InChI | InChI=1S/C27H35NO4S2/c1-29-19-6-5-18-13-26-14-21-22(32-24(33)34-2)12-23(26)28(15-17-3-4-17)8-7-25(26,20(18)11-19)16-27(21)30-9-10-31-27/h5-6,11,17,21-23H,3-4,7-10,12-16H2,1-2H3/t21-,22+,23-,25-,26-/m1/s1 |
| InChIKey | AVNOCHCVSHZDKF-KBDPUJGOSA-N |
| XLogP | 4.55 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|