C11H7N3O3 — CID 71530939
6-(4-hydroxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carbonitrile (PubChem CID 71530939) has the molecular formula C11H7N3O3 and a molecular weight of 229.19 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-(4-hydroxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 71530939 |
| Molecular Formula | C11H7N3O3 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 6-(4-hydroxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(O)cc2)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H7N3O3/c12-5-8-9(13-11(17)14-10(8)16)6-1-3-7(15)4-2-6/h1-4,15H,(H2,13,14,16,17) |
| InChIKey | LNMWCJMERYPIMH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |