About (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate
(3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate (PubChem CID 71532522) has the molecular formula C22H28N2O7S
and a molecular weight of 464.54 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate.
Molecular Properties
| Compound Name | (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate |
| PubChem CID | 71532522 |
| Molecular Formula | C22H28N2O7S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate |
| SMILES | COc1cc(OS(=O)(=O)c2ccc(N3CCN(CC(C)C)C3=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H28N2O7S/c1-15(2)14-23-10-11-24(22(23)25)16-6-8-18(9-7-16)32(26,27)31-17-12-19(28-3)21(30-5)20(13-17)29-4/h6-9,12-13,15H,10-11,14H2,1-5H3 |
| InChIKey | GYHUMKRAZRUUCH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate?
The IUPAC name of (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate (CID 71532522) is (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate.
What is the SMILES notation for (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate?
The canonical SMILES for (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate is COc1cc(OS(=O)(=O)c2ccc(N3CCN(CC(C)C)C3=O)cc2)cc(OC)c1OC.
What is the InChIKey of (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate?
The InChIKey is GYHUMKRAZRUUCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O7S/c1-15(2)14-23-10-11-24(22(23)25)16-6-8-18(9-7-16)32(26,27)31-17-12-19(28-3)21(30-5)20(13-17)29-4/h6-9,12-13,15H,10-11,14H2,1-5H3.
What are the key properties of (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate?
(3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate has a molecular weight of 464.54 g/mol, XLogP of 3.38, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-trimethoxyphenyl) 4-[3-(2-methylpropyl)-2-oxoimidazolidin-1-yl]benzenesulfonate is sourced from PubChem (CID 71532522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).