C24H28O12 — CID 71533181
[2-[(2R,3S,4R,5R,6S)-3-acetyloxy-6-(acetyloxymethyl)-4,5-dihydroxyoxan-2-yl]oxyphenyl]methyl 1-hydroxy-6-oxocyclohex-2-ene-1-carboxylate (PubChem CID 71533181) has the molecular formula C24H28O12 and a molecular weight of 508.48 g/mol. Its IUPAC name is [2-[(2R,3S,4R,5R,6S)-3-acetyloxy-6-(acetyloxymethyl)-4,5-dihydroxyoxan-2-yl]oxyphenyl]methyl 1-hydroxy-6-oxocyclohex-2-ene-1-carboxylate.
| Compound Name | [2-[(2R,3S,4R,5R,6S)-3-acetyloxy-6-(acetyloxymethyl)-4,5-dihydroxyoxan-2-yl]oxyphenyl]methyl 1-hydroxy-6-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 71533181 |
| Molecular Formula | C24H28O12 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | [2-[(2R,3S,4R,5R,6S)-3-acetyloxy-6-(acetyloxymethyl)-4,5-dihydroxyoxan-2-yl]oxyphenyl]methyl 1-hydroxy-6-oxocyclohex-2-ene-1-carboxylate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](Oc2ccccc2COC(=O)C2(O)C=CCCC2=O)[C@@H](OC(C)=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H28O12/c1-13(25)32-12-17-19(28)20(29)21(34-14(2)26)22(36-17)35-16-8-4-3-7-15(16)11-33-23(30)24(31)10-6-5-9-18(24)27/h3-4,6-8,10,17,19-22,28-29,31H,5,9,11-12H2,1-2H3/t17-,19-,20+,21-,22-,24?/m0/s1 |
| InChIKey | PBXPZEIIIRXJCN-RSTXKSQBSA-N |
| XLogP | -0.30 |
| TPSA | 175.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|