C28H28O13 — CID 164724861
[2-[(2R,3R,5R)-3-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (9S)-5,6,9-trihydroxy-10-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9-carboxylate (PubChem CID 164724861) has the molecular formula C28H28O13 and a molecular weight of 572.52 g/mol. Its IUPAC name is [2-[(2R,3R,5R)-3-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (9S)-5,6,9-trihydroxy-10-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9-carboxylate.
| Compound Name | [2-[(2R,3R,5R)-3-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (9S)-5,6,9-trihydroxy-10-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9-carboxylate |
|---|---|
| PubChem CID | 164724861 |
| Molecular Formula | C28H28O13 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | [2-[(2R,3R,5R)-3-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (9S)-5,6,9-trihydroxy-10-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9-carboxylate |
| SMILES | CC(=O)O[C@@H]1C(O)[C@@H](O)C(CO)O[C@@H]1Oc1ccccc1COC(=O)[C@@]1(O)C(=O)C2C=CC1c1c2ccc(O)c1O |
| InChI | InChI=1S/C28H28O13/c1-12(30)39-24-23(34)22(33)19(10-29)41-26(24)40-18-5-3-2-4-13(18)11-38-27(36)28(37)16-8-6-15(25(28)35)14-7-9-17(31)21(32)20(14)16/h2-9,15-16,19,22-24,26,29,31-34,37H,10-11H2,1H3/t15?,16?,19?,22-,23?,24+,26-,28-/m0/s1 |
| InChIKey | FDCJDIHIBOKWER-AKHAXODWSA-N |
| XLogP | -0.36 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|