C11H13N2NaO5S — CID 71535647
sodium 2-[(4-acetamidophenoxy)carbonylamino]ethanesulfinate (PubChem CID 71535647) has the molecular formula C11H13N2NaO5S and a molecular weight of 308.29 g/mol. Its IUPAC name is sodium 2-[(4-acetamidophenoxy)carbonylamino]ethanesulfinate.
| Compound Name | sodium 2-[(4-acetamidophenoxy)carbonylamino]ethanesulfinate |
|---|---|
| PubChem CID | 71535647 |
| Molecular Formula | C11H13N2NaO5S |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | sodium 2-[(4-acetamidophenoxy)carbonylamino]ethanesulfinate |
| SMILES | CC(=O)Nc1ccc(OC(=O)NCCS(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C11H14N2O5S.Na/c1-8(14)13-9-2-4-10(5-3-9)18-11(15)12-6-7-19(16)17;/h2-5H,6-7H2,1H3,(H,12,15)(H,13,14)(H,16,17);/q;+1/p-1 |
| InChIKey | SYQUKTWYYPFLTP-UHFFFAOYSA-M |
| XLogP | -2.38 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|