C30H36N2O6 — CID 158632418
[4-(2-methylprop-2-enoylamino)phenyl] 8-[[4-(3-methyl-2-oxobut-3-enyl)phenoxy]carbonylamino]octanoate (PubChem CID 158632418) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is [4-(2-methylprop-2-enoylamino)phenyl] 8-[[4-(3-methyl-2-oxobut-3-enyl)phenoxy]carbonylamino]octanoate.
| Compound Name | [4-(2-methylprop-2-enoylamino)phenyl] 8-[[4-(3-methyl-2-oxobut-3-enyl)phenoxy]carbonylamino]octanoate |
|---|---|
| PubChem CID | 158632418 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | [4-(2-methylprop-2-enoylamino)phenyl] 8-[[4-(3-methyl-2-oxobut-3-enyl)phenoxy]carbonylamino]octanoate |
| SMILES | C=C(C)C(=O)Cc1ccc(OC(=O)NCCCCCCCC(=O)Oc2ccc(NC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C30H36N2O6/c1-21(2)27(33)20-23-11-15-26(16-12-23)38-30(36)31-19-9-7-5-6-8-10-28(34)37-25-17-13-24(14-18-25)32-29(35)22(3)4/h11-18H,1,3,5-10,19-20H2,2,4H3,(H,31,36)(H,32,35) |
| InChIKey | TVLFHINVIJWNJL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|