C47H49N7O9 — CID 163996979
(4-aminophenyl) 8-[(4-aminophenoxy)carbonylamino]octanoate;(4-aminophenyl) N-[4-[4-[(4-aminophenoxy)carbonylamino]phenoxy]phenyl]carbamate (PubChem CID 163996979) has the molecular formula C47H49N7O9 and a molecular weight of 855.95 g/mol. Its IUPAC name is (4-aminophenyl) 8-[(4-aminophenoxy)carbonylamino]octanoate;(4-aminophenyl) N-[4-[4-[(4-aminophenoxy)carbonylamino]phenoxy]phenyl]carbamate.
| Compound Name | (4-aminophenyl) 8-[(4-aminophenoxy)carbonylamino]octanoate;(4-aminophenyl) N-[4-[4-[(4-aminophenoxy)carbonylamino]phenoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 163996979 |
| Molecular Formula | C47H49N7O9 |
| Molecular Weight | 855.95 g/mol |
| Exact Mass | 855.36 |
| IUPAC Name | (4-aminophenyl) 8-[(4-aminophenoxy)carbonylamino]octanoate;(4-aminophenyl) N-[4-[4-[(4-aminophenoxy)carbonylamino]phenoxy]phenyl]carbamate |
| SMILES | Nc1ccc(OC(=O)CCCCCCCNC(=O)Oc2ccc(N)cc2)cc1.Nc1ccc(OC(=O)Nc2ccc(Oc3ccc(NC(=O)Oc4ccc(N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H22N4O5.C21H27N3O4/c27-17-1-9-23(10-2-17)34-25(31)29-19-5-13-21(14-6-19)33-22-15-7-20(8-16-22)30-26(32)35-24-11-3-18(28)4-12-24;22-16-7-11-18(12-8-16)27-20(25)6-4-2-1-3-5-15-24-21(26)28-19-13-9-17(23)10-14-19/h1-16H,27-28H2,(H,29,31)(H,30,32);7-14H,1-6,15,22-23H2,(H,24,26) |
| InChIKey | UFOATGKZRYCSJY-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 254.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.95 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|