C32H40N4O7 — CID 71536691
tert-butyl 4-[[(2S)-1-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 71536691) has the molecular formula C32H40N4O7 and a molecular weight of 592.69 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-1-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2S)-1-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71536691 |
| Molecular Formula | C32H40N4O7 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | tert-butyl 4-[[(2S)-1-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | COc1cc(/C=C/C(=O)NO)ccc1OC[C@H](Cc1c[nH]c2ccccc12)NC(=O)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C32H40N4O7/c1-32(2,3)43-31(39)36-15-13-22(14-16-36)30(38)34-24(18-23-19-33-26-8-6-5-7-25(23)26)20-42-27-11-9-21(17-28(27)41-4)10-12-29(37)35-40/h5-12,17,19,22,24,33,40H,13-16,18,20H2,1-4H3,(H,34,38)(H,35,37)/b12-10+/t24-/m0/s1 |
| InChIKey | OHQHNACKJWVGEP-YKATVRGKSA-N |
| XLogP | 4.45 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|