C23H17NO3S — CID 71540928
12-(4-nitrophenyl)-8,9,10,12-tetrahydrobenzo[a]xanthene-11-thione (PubChem CID 71540928) has the molecular formula C23H17NO3S and a molecular weight of 387.46 g/mol. Its IUPAC name is 12-(4-nitrophenyl)-8,9,10,12-tetrahydrobenzo[a]xanthene-11-thione.
| Compound Name | 12-(4-nitrophenyl)-8,9,10,12-tetrahydrobenzo[a]xanthene-11-thione |
|---|---|
| PubChem CID | 71540928 |
| Molecular Formula | C23H17NO3S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 12-(4-nitrophenyl)-8,9,10,12-tetrahydrobenzo[a]xanthene-11-thione |
| SMILES | O=[N+]([O-])c1ccc(C2C3=C(CCCC3=S)Oc3ccc4ccccc4c32)cc1 |
| InChI | InChI=1S/C23H17NO3S/c25-24(26)16-11-8-15(9-12-16)21-22-17-5-2-1-4-14(17)10-13-19(22)27-18-6-3-7-20(28)23(18)21/h1-2,4-5,8-13,21H,3,6-7H2 |
| InChIKey | RMLZPTYKKXDZCK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|