C25H18N2O3 — CID 70689135
1-(4-methylphenyl)-3-(4-nitrophenyl)-1H-benzo[f][1,3]benzoxazine (PubChem CID 70689135) has the molecular formula C25H18N2O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(4-nitrophenyl)-1H-benzo[f][1,3]benzoxazine.
| Compound Name | 1-(4-methylphenyl)-3-(4-nitrophenyl)-1H-benzo[f][1,3]benzoxazine |
|---|---|
| PubChem CID | 70689135 |
| Molecular Formula | C25H18N2O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-(4-methylphenyl)-3-(4-nitrophenyl)-1H-benzo[f][1,3]benzoxazine |
| SMILES | Cc1ccc(C2N=C(c3ccc([N+](=O)[O-])cc3)Oc3ccc4ccccc4c32)cc1 |
| InChI | InChI=1S/C25H18N2O3/c1-16-6-8-18(9-7-16)24-23-21-5-3-2-4-17(21)12-15-22(23)30-25(26-24)19-10-13-20(14-11-19)27(28)29/h2-15,24H,1H3 |
| InChIKey | KWIHUUGHUSDJDG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|