C16H36N4 — CID 7154580
cis-(7R,14S)-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 7154580) has the molecular formula C16H36N4 and a molecular weight of 284.49 g/mol. Its IUPAC name is cis-(7R,14S)-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | cis-(7R,14S)-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 7154580 |
| Molecular Formula | C16H36N4 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | cis-(7R,14S)-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | C[C@@H]1CC(C)(C)NCCN[C@@H](C)CC(C)(C)NCCN1 |
| InChI | InChI=1S/C16H36N4/c1-13-11-15(3,4)19-10-8-18-14(2)12-16(5,6)20-9-7-17-13/h13-14,17-20H,7-12H2,1-6H3/t13-,14+ |
| InChIKey | XHCNINMOALIGKM-OKILXGFUSA-N |
| XLogP | 1.47 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |